CAS 55817-72-6 is the registry number for 2-Amino-1-benzyl-4,5-dimethyl-1h-pyrrole-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-amino-1-benzyl-4,5-dimethylpyrrole-3-carbonitrile (CAS 55817-72-6) is a chemical compound with the molecular formula C14H15N3 and a molecular weight of 225.29 g/mol. IUPAC name: 2-amino-1-benzyl-4,5-dimethylpyrrole-3-carbonitrile. InChIKey: RJDOFGRDZKVLTM-UHFFFAOYSA-N.
| Molecular formula | C14H15N3 |
|---|---|
| Molecular weight | 225.29 g/mol |
| IUPAC name | 2-amino-1-benzyl-4,5-dimethylpyrrole-3-carbonitrile |
| InChIKey | RJDOFGRDZKVLTM-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C(=C1C#N)N)CC2=CC=CC=C2)C |
Computed by PubChem (NCBI)