CAS 1181893-31-1 appears in our catalog under these names: 2-Chloro-n-[(4-chlorophenyl)methyl]aniline hydrochloride, 95%, 2-Chloro-N-((4-chlorophenyl)methyl)aniline hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-N-[(4-chlorophenyl)methyl]aniline;hydrochloride (CAS 1181893-31-1) is a chemical compound with the molecular formula C13H12Cl3N and a molecular weight of 288.6 g/mol. IUPAC name: 2-chloro-N-[(4-chlorophenyl)methyl]aniline;hydrochloride. InChIKey: GDNYSVSRXZLOIZ-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl3N |
|---|---|
| Molecular weight | 288.6 g/mol |
| IUPAC name | 2-chloro-N-[(4-chlorophenyl)methyl]aniline;hydrochloride |
| InChIKey | GDNYSVSRXZLOIZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NCC2=CC=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)