CAS 618910-51-3 appears in our catalog under these names: [4-(3,4-Dichlorophenyl)phenyl]methylamine hydrochloride, 95%, (3',4'-Dichloro-(1,1'-biphenyl)-4-yl)methanamine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
[4-(3,4-dichlorophenyl)phenyl]methanamine;hydrochloride (CAS 618910-51-3) is a chemical compound with the molecular formula C13H12Cl3N and a molecular weight of 288.6 g/mol. IUPAC name: [4-(3,4-dichlorophenyl)phenyl]methanamine;hydrochloride. InChIKey: JDOPYPNOJWRQJY-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl3N |
|---|---|
| Molecular weight | 288.6 g/mol |
| IUPAC name | [4-(3,4-dichlorophenyl)phenyl]methanamine;hydrochloride |
| InChIKey | JDOPYPNOJWRQJY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)