CAS 5267-41-4 appears in our catalog under these names: Bis(4-chlorophenyl)methanamine hydrochloride, Bis(4-chlorophenyl)methanamine hydrochloride, 97%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
Bis(4-chlorophenyl)methanamine;hydrochloride (CAS 5267-41-4) is a chemical compound with the molecular formula C13H12Cl3N and a molecular weight of 288.6 g/mol. IUPAC name: bis(4-chlorophenyl)methanamine;hydrochloride. InChIKey: MVPCQZCATBVBOJ-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl3N |
|---|---|
| Molecular weight | 288.6 g/mol |
| IUPAC name | bis(4-chlorophenyl)methanamine;hydrochloride |
| InChIKey | MVPCQZCATBVBOJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)Cl)N)Cl.Cl |
Computed by PubChem (NCBI)