Products 1182252-66-9

CAS 1182252-66-9 is the registry number for D-Lysine-13C6. Offered by: TRC, Biosynth. Available pack sizes: 5mg, 1mg.

Structural formula: {0} (CAS {1})

(2R)-2,6-diamino(1,2,3,4,5,6-13C6)hexanoic acid (CAS 1182252-66-9) is a chemical compound with the molecular formula C6H14N2O2 and a molecular weight of 152.14 g/mol. IUPAC name: (2R)-2,6-diamino(1,2,3,4,5,6-13C6)hexanoic acid. InChIKey: KDXKERNSBIXSRK-OQLBFIKQSA-N.

Identity
Molecular formulaC6H14N2O2
Molecular weight152.14 g/mol
IUPAC name(2R)-2,6-diamino(1,2,3,4,5,6-13C6)hexanoic acid
InChIKeyKDXKERNSBIXSRK-OQLBFIKQSA-N
SMILES[13CH2]([13CH2][13CH2]N)[13CH2][13C@H]([13C](=O)O)N

Computed by PubChem (NCBI)

Synonyms: D-Lysine-13C6