Products 736120-85-7

CAS 736120-85-7 is the registry number for DL-Lysine-N6-15N. Offered by: TRC. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

2-amino-6-(15N)azanylhexanoic acid (CAS 736120-85-7) is a chemical compound with the molecular formula C6H14N2O2 and a molecular weight of 147.18 g/mol. IUPAC name: 2-amino-6-(15N)azanylhexanoic acid. InChIKey: KDXKERNSBIXSRK-CDYZYAPPSA-N.

Identity
Molecular formulaC6H14N2O2
Molecular weight147.18 g/mol
IUPAC name2-amino-6-(15N)azanylhexanoic acid
InChIKeyKDXKERNSBIXSRK-CDYZYAPPSA-N
SMILESC(CC[15NH2])CC(C(=O)O)N

Computed by PubChem (NCBI)

Synonyms: DL-Lysine-N6-15N