CAS 55443-57-7 is the registry number for L-Lysine-13C6. Offered by: TRC. Available pack sizes: 25mg.
(2S)-2,6-diamino(1,2,3,4,5,6-13C6)hexanoic acid (CAS 55443-57-7) is a chemical compound with the molecular formula C6H14N2O2 and a molecular weight of 152.14 g/mol. IUPAC name: (2S)-2,6-diamino(1,2,3,4,5,6-13C6)hexanoic acid. InChIKey: KDXKERNSBIXSRK-IQUPZBQQSA-N.
| Molecular formula | C6H14N2O2 |
|---|---|
| Molecular weight | 152.14 g/mol |
| IUPAC name | (2S)-2,6-diamino(1,2,3,4,5,6-13C6)hexanoic acid |
| InChIKey | KDXKERNSBIXSRK-IQUPZBQQSA-N |
| SMILES | [13CH2]([13CH2][13CH2]N)[13CH2][13C@@H]([13C](=O)O)N |
Computed by PubChem (NCBI)