Products 1182344-40-6
CAS 1182344-40-6 appears in our catalog under these names: (4-(3,3-Dimethylureido)phenyl)boronic acid, 95%, 95%, (4-(3,3-Dimethylureido)phenyl)boronic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
[4-(dimethylcarbamoylamino)phenyl]boronic acid (CAS 1182344-40-6) is a chemical compound with the molecular formula C9H13BN2O3 and a molecular weight of 208.02 g/mol. IUPAC name: [4-(dimethylcarbamoylamino)phenyl]boronic acid. InChIKey: HEGGSLKFJQGEEI-UHFFFAOYSA-N.
| Molecular formula | C9H13BN2O3 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | [4-(dimethylcarbamoylamino)phenyl]boronic acid |
| InChIKey | HEGGSLKFJQGEEI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NC(=O)N(C)C)(O)O |
Computed by PubChem (NCBI)