Products 1182838-07-8
CAS 1182838-07-8 appears in our catalog under these names: Methyl 3,4,5-Trimethoxy-d9-benzoate, 99 atom % D, min 98% Chemical Purity, Methyl 3,4,5-trimethoxybenzoate-d9. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 0,5g, 1 mg.
Methyl 3,4,5-tris(trideuteriomethoxy)benzoate (CAS 1182838-07-8) is a chemical compound with the molecular formula C11H14O5 and a molecular weight of 235.28 g/mol. IUPAC name: methyl 3,4,5-tris(trideuteriomethoxy)benzoate. InChIKey: KACHFMOHOPLTNX-GQALSZNTSA-N.
| Molecular formula | C11H14O5 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | methyl 3,4,5-tris(trideuteriomethoxy)benzoate |
| InChIKey | KACHFMOHOPLTNX-GQALSZNTSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=CC(=C1OC([2H])([2H])[2H])OC([2H])([2H])[2H])C(=O)OC |
Computed by PubChem (NCBI)