Products 1183010-95-8
CAS 1183010-95-8 appears in our catalog under these names: (3-Bromophenyl)(cyclohexyl)methanol, 95%, 95%, Cyclohexyl (3-bromophenyl)methanol, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3-bromophenyl)-cyclohexylmethanol (CAS 1183010-95-8) is a chemical compound with the molecular formula C13H17BrO and a molecular weight of 269.18 g/mol. IUPAC name: (3-bromophenyl)-cyclohexylmethanol. InChIKey: CJJAYOUEMHOFOF-UHFFFAOYSA-N.
| Molecular formula | C13H17BrO |
|---|---|
| Molecular weight | 269.18 g/mol |
| IUPAC name | (3-bromophenyl)-cyclohexylmethanol |
| InChIKey | CJJAYOUEMHOFOF-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(C2=CC(=CC=C2)Br)O |
Computed by PubChem (NCBI)