CAS 118306-76-6 appears in our catalog under these names: Diclofenac Impurity 12, Diclofenac sodium Impurity 50. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-chloroethyl)-1,3-dihydroindol-2-one (CAS 118306-76-6) is a chemical compound with the molecular formula C10H10ClNO and a molecular weight of 195.64 g/mol. IUPAC name: 5-(2-chloroethyl)-1,3-dihydroindol-2-one. InChIKey: HPXJIGZLXHQSGU-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | 5-(2-chloroethyl)-1,3-dihydroindol-2-one |
| InChIKey | HPXJIGZLXHQSGU-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)CCCl)NC1=O |
Computed by PubChem (NCBI)