CAS 1183104-54-2 is the registry number for 2-Amino-2-(3-(trifluoromethyl)phenyl)propanamide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-amino-2-[3-(trifluoromethyl)phenyl]propanamide (CAS 1183104-54-2) is a chemical compound with the molecular formula C10H11F3N2O and a molecular weight of 232.20 g/mol. IUPAC name: 2-amino-2-[3-(trifluoromethyl)phenyl]propanamide. InChIKey: UNGTZAKKKXQMGE-UHFFFAOYSA-N.
| Molecular formula | C10H11F3N2O |
|---|---|
| Molecular weight | 232.20 g/mol |
| IUPAC name | 2-amino-2-[3-(trifluoromethyl)phenyl]propanamide |
| InChIKey | UNGTZAKKKXQMGE-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)C(F)(F)F)(C(=O)N)N |
Computed by PubChem (NCBI)