Products 1183184-66-8
CAS 1183184-66-8 is the registry number for 2-Chloro-N-(propan-2-yl)-N-(2,2,2-trifluoroethyl)acetamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)acetamide (CAS 1183184-66-8) is a chemical compound with the molecular formula C7H11ClF3NO and a molecular weight of 217.61 g/mol. IUPAC name: 2-chloro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)acetamide. InChIKey: JXEUPQZJHKBZML-UHFFFAOYSA-N.
| Molecular formula | C7H11ClF3NO |
|---|---|
| Molecular weight | 217.61 g/mol |
| IUPAC name | 2-chloro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)acetamide |
| InChIKey | JXEUPQZJHKBZML-UHFFFAOYSA-N |
| SMILES | CC(C)N(CC(F)(F)F)C(=O)CCl |
Computed by PubChem (NCBI)