Products 2137916-74-4
CAS 2137916-74-4 appears in our catalog under these names: 5-(Trifluoromethyl)-2-azabicyclo(2.2.1)heptan-5-ol hydrochloride, 95%, 5-(Trifluoromethyl)-2-azabicyclo(2.2.1)heptan-5-ol hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 50mg, 250mg, 1000mg, 500mg.
5-(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-5-ol;hydrochloride (CAS 2137916-74-4) is a chemical compound with the molecular formula C7H11ClF3NO and a molecular weight of 217.61 g/mol. IUPAC name: 5-(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-5-ol;hydrochloride. InChIKey: SNJYCCFUGVBFDQ-UHFFFAOYSA-N.
| Molecular formula | C7H11ClF3NO |
|---|---|
| Molecular weight | 217.61 g/mol |
| IUPAC name | 5-(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-5-ol;hydrochloride |
| InChIKey | SNJYCCFUGVBFDQ-UHFFFAOYSA-N |
| SMILES | C1C2CC(C1CN2)(C(F)(F)F)O.Cl |
Computed by PubChem (NCBI)