CAS 1461706-48-8 is the registry number for 6-(Trifluoromethyl)-2-azabicyclo(2.2.1)heptan-6-ol hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-ol;hydrochloride (CAS 1461706-48-8) is a chemical compound with the molecular formula C7H11ClF3NO and a molecular weight of 217.61 g/mol. IUPAC name: 6-(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-ol;hydrochloride. InChIKey: ISEDTDXTWIGLNB-UHFFFAOYSA-N.
| Molecular formula | C7H11ClF3NO |
|---|---|
| Molecular weight | 217.61 g/mol |
| IUPAC name | 6-(trifluoromethyl)-2-azabicyclo[2.2.1]heptan-6-ol;hydrochloride |
| InChIKey | ISEDTDXTWIGLNB-UHFFFAOYSA-N |
| SMILES | C1C2CC(C1NC2)(C(F)(F)F)O.Cl |
Computed by PubChem (NCBI)