CAS 1183262-68-1 is the registry number for 2-Ethyl-1,3-benzoxazole-5-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-ethyl-1,3-benzoxazole-5-sulfonyl chloride (CAS 1183262-68-1) is a chemical compound with the molecular formula C9H8ClNO3S and a molecular weight of 245.68 g/mol. IUPAC name: 2-ethyl-1,3-benzoxazole-5-sulfonyl chloride. InChIKey: LKWUMIFXOVBJJM-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3S |
|---|---|
| Molecular weight | 245.68 g/mol |
| IUPAC name | 2-ethyl-1,3-benzoxazole-5-sulfonyl chloride |
| InChIKey | LKWUMIFXOVBJJM-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=C(O1)C=CC(=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)