Products 1183262-68-1

CAS 1183262-68-1 is the registry number for 2-Ethyl-1,3-benzoxazole-5-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-ethyl-1,3-benzoxazole-5-sulfonyl chloride (CAS 1183262-68-1) is a chemical compound with the molecular formula C9H8ClNO3S and a molecular weight of 245.68 g/mol. IUPAC name: 2-ethyl-1,3-benzoxazole-5-sulfonyl chloride. InChIKey: LKWUMIFXOVBJJM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClNO3S
Molecular weight245.68 g/mol
IUPAC name2-ethyl-1,3-benzoxazole-5-sulfonyl chloride
InChIKeyLKWUMIFXOVBJJM-UHFFFAOYSA-N
SMILESCCC1=NC2=C(O1)C=CC(=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)