CAS 166883-20-1 appears in our catalog under these names: 1-Methyl-2-oxindole-5-sulphonyl chloride, 1-Methyl-2-oxo-5-indolinesulfonyl chloride, 98%, 1-Methyl-2-oxo-2,3-dihydro-1H-indole-5-sulfonyl chloride, 96%. Offered by: Biosynth, Combi-blocks, Fluorochem. Available pack sizes: 2,5g, 5g, 1g, 25g, 10g, 250mg.
1-methyl-2-oxo-3H-indole-5-sulfonyl chloride (CAS 166883-20-1) is a chemical compound with the molecular formula C9H8ClNO3S and a molecular weight of 245.68 g/mol. IUPAC name: 1-methyl-2-oxo-3H-indole-5-sulfonyl chloride. InChIKey: YFRKJJDSYAKRAU-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3S |
|---|---|
| Molecular weight | 245.68 g/mol |
| IUPAC name | 1-methyl-2-oxo-3H-indole-5-sulfonyl chloride |
| InChIKey | YFRKJJDSYAKRAU-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC2=C1C=CC(=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)