CAS 854137-61-4 appears in our catalog under these names: 3-METHYL-2-OXOINDOLINE-5-SULFONYL CHLORIDE, 95%, 95%, 3-Methyl-2-oxo-2,3-dihydro-1H-indole-5-sulfonyl chloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-methyl-2-oxo-1,3-dihydroindole-5-sulfonyl chloride (CAS 854137-61-4) is a chemical compound with the molecular formula C9H8ClNO3S and a molecular weight of 245.68 g/mol. IUPAC name: 3-methyl-2-oxo-1,3-dihydroindole-5-sulfonyl chloride. InChIKey: JIIBYPZOZQAHSR-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3S |
|---|---|
| Molecular weight | 245.68 g/mol |
| IUPAC name | 3-methyl-2-oxo-1,3-dihydroindole-5-sulfonyl chloride |
| InChIKey | JIIBYPZOZQAHSR-UHFFFAOYSA-N |
| SMILES | CC1C2=C(C=CC(=C2)S(=O)(=O)Cl)NC1=O |
Computed by PubChem (NCBI)