Products 854137-61-4

CAS 854137-61-4 appears in our catalog under these names: 3-METHYL-2-OXOINDOLINE-5-SULFONYL CHLORIDE, 95%, 95%, 3-Methyl-2-oxo-2,3-dihydro-1H-indole-5-sulfonyl chloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-methyl-2-oxo-1,3-dihydroindole-5-sulfonyl chloride (CAS 854137-61-4) is a chemical compound with the molecular formula C9H8ClNO3S and a molecular weight of 245.68 g/mol. IUPAC name: 3-methyl-2-oxo-1,3-dihydroindole-5-sulfonyl chloride. InChIKey: JIIBYPZOZQAHSR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClNO3S
Molecular weight245.68 g/mol
IUPAC name3-methyl-2-oxo-1,3-dihydroindole-5-sulfonyl chloride
InChIKeyJIIBYPZOZQAHSR-UHFFFAOYSA-N
SMILESCC1C2=C(C=CC(=C2)S(=O)(=O)Cl)NC1=O

Computed by PubChem (NCBI)