Products 1183308-29-3

CAS 1183308-29-3 is the registry number for 3-Bromo-5-(chlorosulfonyl)benzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

3-bromo-5-chlorosulfonylbenzoic acid (CAS 1183308-29-3) is a chemical compound with the molecular formula C7H4BrClO4S and a molecular weight of 299.53 g/mol. IUPAC name: 3-bromo-5-chlorosulfonylbenzoic acid. InChIKey: IMAIAELPYHNWME-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BrClO4S
Molecular weight299.53 g/mol
IUPAC name3-bromo-5-chlorosulfonylbenzoic acid
InChIKeyIMAIAELPYHNWME-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1S(=O)(=O)Cl)Br)C(=O)O

Computed by PubChem (NCBI)