CAS 503446-59-1 appears in our catalog under these names: 3-Bromo-4-(chlorosulfonyl)benzoic acid, 97%, 3-Bromo-4-(chlorosulfonyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-bromo-4-chlorosulfonylbenzoic acid (CAS 503446-59-1) is a chemical compound with the molecular formula C7H4BrClO4S and a molecular weight of 299.53 g/mol. IUPAC name: 3-bromo-4-chlorosulfonylbenzoic acid. InChIKey: GPWHRNMCQJYAAJ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClO4S |
|---|---|
| Molecular weight | 299.53 g/mol |
| IUPAC name | 3-bromo-4-chlorosulfonylbenzoic acid |
| InChIKey | GPWHRNMCQJYAAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)