Products 1375473-34-9

CAS 1375473-34-9 is the registry number for 2-Bromo-4-(chlorosulfonyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2-bromo-4-chlorosulfonylbenzoic acid (CAS 1375473-34-9) is a chemical compound with the molecular formula C7H4BrClO4S and a molecular weight of 299.53 g/mol. IUPAC name: 2-bromo-4-chlorosulfonylbenzoic acid. InChIKey: IYVCPLAPEBDDBD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BrClO4S
Molecular weight299.53 g/mol
IUPAC name2-bromo-4-chlorosulfonylbenzoic acid
InChIKeyIYVCPLAPEBDDBD-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1S(=O)(=O)Cl)Br)C(=O)O

Computed by PubChem (NCBI)