CAS 1375473-34-9 is the registry number for 2-Bromo-4-(chlorosulfonyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-bromo-4-chlorosulfonylbenzoic acid (CAS 1375473-34-9) is a chemical compound with the molecular formula C7H4BrClO4S and a molecular weight of 299.53 g/mol. IUPAC name: 2-bromo-4-chlorosulfonylbenzoic acid. InChIKey: IYVCPLAPEBDDBD-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClO4S |
|---|---|
| Molecular weight | 299.53 g/mol |
| IUPAC name | 2-bromo-4-chlorosulfonylbenzoic acid |
| InChIKey | IYVCPLAPEBDDBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)Br)C(=O)O |
Computed by PubChem (NCBI)