Products 1183332-03-7

CAS 1183332-03-7 is the registry number for 2-(4-Methylpiperidine-1-carbonyl)cyclopropane-1-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4-methylpiperidine-1-carbonyl)cyclopropane-1-carboxylic acid (CAS 1183332-03-7) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: 2-(4-methylpiperidine-1-carbonyl)cyclopropane-1-carboxylic acid. InChIKey: VBWURTXETORTQH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17NO3
Molecular weight211.26 g/mol
IUPAC name2-(4-methylpiperidine-1-carbonyl)cyclopropane-1-carboxylic acid
InChIKeyVBWURTXETORTQH-UHFFFAOYSA-N
SMILESCC1CCN(CC1)C(=O)C2CC2C(=O)O

Computed by PubChem (NCBI)