CAS 1183360-25-9 appears in our catalog under these names: 4-((3-Amino-1H-1,2,4-triazol-1-yl)methyl)benzonitrile, 95%, 4-((3-Amino-1H-1,2,4-triazol-1-yl)methyl)benzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-[(3-amino-1,2,4-triazol-1-yl)methyl]benzonitrile (CAS 1183360-25-9) is a chemical compound with the molecular formula C10H9N5 and a molecular weight of 199.21 g/mol. IUPAC name: 4-[(3-amino-1,2,4-triazol-1-yl)methyl]benzonitrile. InChIKey: SPAROXQKHLQKCY-UHFFFAOYSA-N.
| Molecular formula | C10H9N5 |
|---|---|
| Molecular weight | 199.21 g/mol |
| IUPAC name | 4-[(3-amino-1,2,4-triazol-1-yl)methyl]benzonitrile |
| InChIKey | SPAROXQKHLQKCY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=NC(=N2)N)C#N |
Computed by PubChem (NCBI)