CAS 78650-16-5 appears in our catalog under these names: 4-Methyl[1,3,5]triazino[1,2-a]benzimidazol-2-amine, 95%, 4-Methylbenzo(4,5)imidazo(1,2-a)(1,3,5)triazin-2-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
4-methyl-[1,3,5]triazino[1,2-a]benzimidazol-2-amine (CAS 78650-16-5) is a chemical compound with the molecular formula C10H9N5 and a molecular weight of 199.21 g/mol. IUPAC name: 4-methyl-[1,3,5]triazino[1,2-a]benzimidazol-2-amine. InChIKey: JYUMVHXSEQXABG-UHFFFAOYSA-N.
| Molecular formula | C10H9N5 |
|---|---|
| Molecular weight | 199.21 g/mol |
| IUPAC name | 4-methyl-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
| InChIKey | JYUMVHXSEQXABG-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC2=NC3=CC=CC=C3N12)N |
Computed by PubChem (NCBI)