CAS 1306604-22-7 appears in our catalog under these names: 3-Amino-1-(4-aminophenyl)-1H-pyrazole-4-carbonitrile, 95%, 3-Amino-1-(4-aminophenyl)-1H-pyrazole-4-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-amino-1-(4-aminophenyl)pyrazole-4-carbonitrile (CAS 1306604-22-7) is a chemical compound with the molecular formula C10H9N5 and a molecular weight of 199.21 g/mol. IUPAC name: 3-amino-1-(4-aminophenyl)pyrazole-4-carbonitrile. InChIKey: YQCAFPXSADHHFZ-UHFFFAOYSA-N.
| Molecular formula | C10H9N5 |
|---|---|
| Molecular weight | 199.21 g/mol |
| IUPAC name | 3-amino-1-(4-aminophenyl)pyrazole-4-carbonitrile |
| InChIKey | YQCAFPXSADHHFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)N2C=C(C(=N2)N)C#N |
Computed by PubChem (NCBI)