CAS 1183362-22-2 appears in our catalog under these names: N-Methyl-4-{(5-(trifluoromethyl)pyridin-2-yl)oxy}aniline, 95%, N-Methyl-4-{(5-(trifluoromethyl)pyridin-2-yl)oxy}aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
N-methyl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]aniline (CAS 1183362-22-2) is a chemical compound with the molecular formula C13H11F3N2O and a molecular weight of 268.23 g/mol. IUPAC name: N-methyl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]aniline. InChIKey: AMPKCSDOQIIDTD-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | N-methyl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]aniline |
| InChIKey | AMPKCSDOQIIDTD-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C=C1)OC2=NC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)