CAS 1354954-37-2 appears in our catalog under these names: 1-(3,5-Dimethyl-1-phenyl-1H-pyrazol-4-yl)-2,2,2-trifluoroethan-1-one, 95%, 1-(3,5-Dimethyl-1-phenyl-1H-pyrazol-4-yl)-2,2,2-trifluoroethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2,2,2-trifluoroethanone (CAS 1354954-37-2) is a chemical compound with the molecular formula C13H11F3N2O and a molecular weight of 268.23 g/mol. IUPAC name: 1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2,2,2-trifluoroethanone. InChIKey: BILREAOGAADGTO-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | 1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2,2,2-trifluoroethanone |
| InChIKey | BILREAOGAADGTO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=CC=C2)C)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)