CAS 933705-41-0 is the registry number for {2-(3-(Trifluoromethyl)phenoxy)pyridin-3-yl}methanamine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methanamine (CAS 933705-41-0) is a chemical compound with the molecular formula C13H11F3N2O and a molecular weight of 268.23 g/mol. IUPAC name: [2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methanamine. InChIKey: MEXZELPJNXBSLC-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | [2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methanamine |
| InChIKey | MEXZELPJNXBSLC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=C(C=CC=N2)CN)C(F)(F)F |
Computed by PubChem (NCBI)