Products 1183425-33-3
CAS 1183425-33-3 is the registry number for 5-((Ethoxycarbonyl)amino)-2-fluorobenzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-(ethoxycarbonylamino)-2-fluorobenzoic acid (CAS 1183425-33-3) is a chemical compound with the molecular formula C10H10FNO4 and a molecular weight of 227.19 g/mol. IUPAC name: 5-(ethoxycarbonylamino)-2-fluorobenzoic acid. InChIKey: RBLYLLHPWSXXRW-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO4 |
|---|---|
| Molecular weight | 227.19 g/mol |
| IUPAC name | 5-(ethoxycarbonylamino)-2-fluorobenzoic acid |
| InChIKey | RBLYLLHPWSXXRW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC1=CC(=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)