Products 1183478-58-1

CAS 1183478-58-1 is the registry number for 4-((N-Methylbutyramido)methyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[[butanoyl(methyl)amino]methyl]benzoic acid (CAS 1183478-58-1) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: 4-[[butanoyl(methyl)amino]methyl]benzoic acid. InChIKey: HDPHSYDZJLTRPT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17NO3
Molecular weight235.28 g/mol
IUPAC name4-[[butanoyl(methyl)amino]methyl]benzoic acid
InChIKeyHDPHSYDZJLTRPT-UHFFFAOYSA-N
SMILESCCCC(=O)N(C)CC1=CC=C(C=C1)C(=O)O

Computed by PubChem (NCBI)