Products 1246816-59-0
CAS 1246816-59-0 is the registry number for Carbovir-13C,d2. Offered by: Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 0,5mg, 5mg, 1mg.
2-amino-9-[4-[dideuterio(hydroxy)methyl]cyclopent-2-en-1-yl]-1H-purin-6-one (CAS 1246816-59-0) is a chemical compound with the molecular formula C11H13N5O2 and a molecular weight of 250.26 g/mol. IUPAC name: 2-amino-9-[4-[dideuterio(hydroxy)methyl]cyclopent-2-en-1-yl]-1H-purin-6-one. InChIKey: XSSYCIGJYCVRRK-TTYOAZMQSA-N.
| Molecular formula | C11H13N5O2 |
|---|---|
| Molecular weight | 250.26 g/mol |
| IUPAC name | 2-amino-9-[4-[dideuterio(hydroxy)methyl]cyclopent-2-en-1-yl]-1H-purin-6-one |
| InChIKey | XSSYCIGJYCVRRK-TTYOAZMQSA-N |
| SMILES | [2H]C([2H])(C1CC(C=C1)N2[13CH]=NC3=C2N=C(NC3=O)N)O |
Computed by PubChem (NCBI)