Products 1183543-86-3
CAS 1183543-86-3 is the registry number for N-(6-Aminopyridin-3-yl)-5-chloro-2-methylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-(6-amino-3-pyridinyl)-5-chloro-2-methylbenzenesulfonamide (CAS 1183543-86-3) is a chemical compound with the molecular formula C12H12ClN3O2S and a molecular weight of 297.76 g/mol. IUPAC name: N-(6-amino-3-pyridinyl)-5-chloro-2-methylbenzenesulfonamide. InChIKey: TXMZSWBHWIWURP-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3O2S |
|---|---|
| Molecular weight | 297.76 g/mol |
| IUPAC name | N-(6-amino-3-pyridinyl)-5-chloro-2-methylbenzenesulfonamide |
| InChIKey | TXMZSWBHWIWURP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)S(=O)(=O)NC2=CN=C(C=C2)N |
Computed by PubChem (NCBI)