CAS 1340970-32-2 is the registry number for 2-[(4-Chloro-3-methylphenyl)amino]pyridine-3-sulfonamide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(4-chloro-3-methylanilino)pyridine-3-sulfonamide (CAS 1340970-32-2) is a chemical compound with the molecular formula C12H12ClN3O2S and a molecular weight of 297.76 g/mol. IUPAC name: 2-(4-chloro-3-methylanilino)pyridine-3-sulfonamide. InChIKey: IGQFVMLXALIZOV-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3O2S |
|---|---|
| Molecular weight | 297.76 g/mol |
| IUPAC name | 2-(4-chloro-3-methylanilino)pyridine-3-sulfonamide |
| InChIKey | IGQFVMLXALIZOV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC2=C(C=CC=N2)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)