CAS 328028-33-7 appears in our catalog under these names: 2,5-Diamino-n-(2-chlorophenyl)benzenesulfonamide, 95%, 2,5-Diamino-N-(2-chlorophenyl)benzene-1-sulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
2,5-diamino-N-(2-chlorophenyl)benzenesulfonamide (CAS 328028-33-7) is a chemical compound with the molecular formula C12H12ClN3O2S and a molecular weight of 297.76 g/mol. IUPAC name: 2,5-diamino-N-(2-chlorophenyl)benzenesulfonamide. InChIKey: JITPMZCIAFVJHS-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3O2S |
|---|---|
| Molecular weight | 297.76 g/mol |
| IUPAC name | 2,5-diamino-N-(2-chlorophenyl)benzenesulfonamide |
| InChIKey | JITPMZCIAFVJHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NS(=O)(=O)C2=C(C=CC(=C2)N)N)Cl |
Computed by PubChem (NCBI)