CAS 1183817-12-0 is the registry number for 4,6-Dimethyl-2-oxo-N-(1H-pyrazol-4-ylmethyl)-1,2-dihydropyridine-3-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4,6-dimethyl-2-oxo-N-(1H-pyrazol-4-ylmethyl)-1H-pyridine-3-carboxamide (CAS 1183817-12-0) is a chemical compound with the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. IUPAC name: 4,6-dimethyl-2-oxo-N-(1H-pyrazol-4-ylmethyl)-1H-pyridine-3-carboxamide. InChIKey: PSYXUJNIOOEULC-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O2 |
|---|---|
| Molecular weight | 246.27 g/mol |
| IUPAC name | 4,6-dimethyl-2-oxo-N-(1H-pyrazol-4-ylmethyl)-1H-pyridine-3-carboxamide |
| InChIKey | PSYXUJNIOOEULC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1)C(=O)NCC2=CNN=C2)C |
Computed by PubChem (NCBI)