Products 1183845-86-4
CAS 1183845-86-4 appears in our catalog under these names: 4-((N,2-Dimethylpropanamido)methyl)benzoic acid, 4-[(N,2-Dimethylpropanamido)methyl]benzoic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 250mg, 1g, 5g.
4-[[methyl(2-methylpropanoyl)amino]methyl]benzoic acid (CAS 1183845-86-4) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: 4-[[methyl(2-methylpropanoyl)amino]methyl]benzoic acid. InChIKey: OZRIGBUKQICXAE-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 4-[[methyl(2-methylpropanoyl)amino]methyl]benzoic acid |
| InChIKey | OZRIGBUKQICXAE-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)N(C)CC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)