CAS 1183965-54-9 is the registry number for (4-Bromo-2-chloro-benzyl)-cyclopropylmethyl-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
N-[(4-bromo-2-chlorophenyl)methyl]-1-cyclopropylmethanamine (CAS 1183965-54-9) is a chemical compound with the molecular formula C11H13BrClN and a molecular weight of 274.58 g/mol. IUPAC name: N-[(4-bromo-2-chlorophenyl)methyl]-1-cyclopropylmethanamine. InChIKey: OWEKISQKIJOGAK-UHFFFAOYSA-N.
| Molecular formula | C11H13BrClN |
|---|---|
| Molecular weight | 274.58 g/mol |
| IUPAC name | N-[(4-bromo-2-chlorophenyl)methyl]-1-cyclopropylmethanamine |
| InChIKey | OWEKISQKIJOGAK-UHFFFAOYSA-N |
| SMILES | C1CC1CNCC2=C(C=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)