Products 2741234-92-2
CAS 2741234-92-2 is the registry number for 3-(3-Bromophenyl)bicyclo(1.1.1)pentan-1-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g, 100mg.
3-(3-bromophenyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride (CAS 2741234-92-2) is a chemical compound with the molecular formula C11H13BrClN and a molecular weight of 274.58 g/mol. IUPAC name: 3-(3-bromophenyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride. InChIKey: LUCZJURFKWVWQA-UHFFFAOYSA-N.
| Molecular formula | C11H13BrClN |
|---|---|
| Molecular weight | 274.58 g/mol |
| IUPAC name | 3-(3-bromophenyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride |
| InChIKey | LUCZJURFKWVWQA-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)N)C3=CC(=CC=C3)Br.Cl |
Computed by PubChem (NCBI)