Products 1311197-81-5
CAS 1311197-81-5 appears in our catalog under these names: 1-(4-Bromo-3-chlorophenyl)piperidine, 96%, 1-(4-Bromo-3-chlorophenyl)piperidine. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 5g, 1g.
1-(4-bromo-3-chlorophenyl)piperidine (CAS 1311197-81-5) is a chemical compound with the molecular formula C11H13BrClN and a molecular weight of 274.58 g/mol. IUPAC name: 1-(4-bromo-3-chlorophenyl)piperidine. InChIKey: BYODOHYKGIBOIL-UHFFFAOYSA-N.
| Molecular formula | C11H13BrClN |
|---|---|
| Molecular weight | 274.58 g/mol |
| IUPAC name | 1-(4-bromo-3-chlorophenyl)piperidine |
| InChIKey | BYODOHYKGIBOIL-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CC(=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)