Products 1184018-54-9

CAS 1184018-54-9 is the registry number for Methyl 2-methyl-2-((2,2,2-trifluoroethyl)amino)propanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate (CAS 1184018-54-9) is a chemical compound with the molecular formula C7H12F3NO2 and a molecular weight of 199.17 g/mol. IUPAC name: methyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate. InChIKey: GTTFZTIGJMHCRK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12F3NO2
Molecular weight199.17 g/mol
IUPAC namemethyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate
InChIKeyGTTFZTIGJMHCRK-UHFFFAOYSA-N
SMILESCC(C)(C(=O)OC)NCC(F)(F)F

Computed by PubChem (NCBI)