CAS 1184023-09-3 is the registry number for 2-(4-Bromopyrazol-1-yl)benzonitrile, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(4-bromopyrazol-1-yl)benzonitrile (CAS 1184023-09-3) is a chemical compound with the molecular formula C10H6BrN3 and a molecular weight of 248.08 g/mol. IUPAC name: 2-(4-bromopyrazol-1-yl)benzonitrile. InChIKey: RPTLEHPSCLVUDJ-UHFFFAOYSA-N.
| Molecular formula | C10H6BrN3 |
|---|---|
| Molecular weight | 248.08 g/mol |
| IUPAC name | 2-(4-bromopyrazol-1-yl)benzonitrile |
| InChIKey | RPTLEHPSCLVUDJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)N2C=C(C=N2)Br |
Computed by PubChem (NCBI)