CAS 1888810-25-0 is the registry number for 8-Bromo-[1,2,4]triazolo[4,3-a]quinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-[1,2,4]triazolo[4,3-a]quinoline (CAS 1888810-25-0) is a chemical compound with the molecular formula C10H6BrN3 and a molecular weight of 248.08 g/mol. IUPAC name: 8-bromo-[1,2,4]triazolo[4,3-a]quinoline. InChIKey: HRNZFMNZSHQKQC-UHFFFAOYSA-N.
| Molecular formula | C10H6BrN3 |
|---|---|
| Molecular weight | 248.08 g/mol |
| IUPAC name | 8-bromo-[1,2,4]triazolo[4,3-a]quinoline |
| InChIKey | HRNZFMNZSHQKQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC3=NN=CN32)Br |
Computed by PubChem (NCBI)