CAS 1699749-05-7 appears in our catalog under these names: 2-Bromo-9h-pyrrolo[2,3-b:4,5-c']dipyridine, 97%, 2-Bromo-9H-pyrrolo(2,3-B:4,5-C)dipyridine, 2-Bromo-9H-pyrrolo[2,3-b:4,5-c’]dipyridine, 95%, 95%, 2-Bromo-9H-pyrrolo[2,3-b:4,5-c']dipyridine, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 500mg, 1000mg, 50mg.
11-bromo-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (CAS 1699749-05-7) is a chemical compound with the molecular formula C10H6BrN3 and a molecular weight of 248.08 g/mol. IUPAC name: 11-bromo-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene. InChIKey: FYFAESRRWBSTMD-UHFFFAOYSA-N.
| Molecular formula | C10H6BrN3 |
|---|---|
| Molecular weight | 248.08 g/mol |
| IUPAC name | 11-bromo-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| InChIKey | FYFAESRRWBSTMD-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C3=C(N2)C=CN=C3)Br |
Computed by PubChem (NCBI)