CAS 1184181-48-3 appears in our catalog under these names: 2,4–Dihydroxy–5–isopropylbenzoic acid, 2,4-Dihydroxy-5-isopropylbenzoic acid 95%, 2,4-Dihydroxy-5-isopropylbenzoic acid, 98%, 98%, 2,4-DIHYDROXY-5-ISOPROPYLBENZOIC ACID, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g, 100g, 500mg, 10g.
2,4-dihydroxy-5-propan-2-ylbenzoic acid (CAS 1184181-48-3) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: 2,4-dihydroxy-5-propan-2-ylbenzoic acid. InChIKey: JAMMFVLHQOLNOP-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 2,4-dihydroxy-5-propan-2-ylbenzoic acid |
| InChIKey | JAMMFVLHQOLNOP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C=C1O)O)C(=O)O |
Computed by PubChem (NCBI)