CAS 1184365-73-8 appears in our catalog under these names: 4-Chloro-8-fluoro-2,3-dimethylquinoline, 4-Chloro-8-fluoro-2,3-dimethylquinoline, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
4-chloro-8-fluoro-2,3-dimethylquinoline (CAS 1184365-73-8) is a chemical compound with the molecular formula C11H9ClFN and a molecular weight of 209.65 g/mol. IUPAC name: 4-chloro-8-fluoro-2,3-dimethylquinoline. InChIKey: RAISIDMLUYCCFJ-UHFFFAOYSA-N.
| Molecular formula | C11H9ClFN |
|---|---|
| Molecular weight | 209.65 g/mol |
| IUPAC name | 4-chloro-8-fluoro-2,3-dimethylquinoline |
| InChIKey | RAISIDMLUYCCFJ-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C(=C1Cl)C=CC=C2F)C |
Computed by PubChem (NCBI)