CAS 175204-94-1 is the registry number for 2-Chloro-5-fluoro-3,8-dimethylquinoline, 95%. Offered by: Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g.
2-chloro-5-fluoro-3,8-dimethylquinoline (CAS 175204-94-1) is a chemical compound with the molecular formula C11H9ClFN and a molecular weight of 209.65 g/mol. IUPAC name: 2-chloro-5-fluoro-3,8-dimethylquinoline. InChIKey: VHZSLPPYDBJXMQ-UHFFFAOYSA-N.
| Molecular formula | C11H9ClFN |
|---|---|
| Molecular weight | 209.65 g/mol |
| IUPAC name | 2-chloro-5-fluoro-3,8-dimethylquinoline |
| InChIKey | VHZSLPPYDBJXMQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)F)C=C(C(=N2)Cl)C |
Computed by PubChem (NCBI)