Products 175204-94-1

CAS 175204-94-1 is the registry number for 2-Chloro-5-fluoro-3,8-dimethylquinoline, 95%. Offered by: Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g.

Structural formula: {0} (CAS {1})

2-chloro-5-fluoro-3,8-dimethylquinoline (CAS 175204-94-1) is a chemical compound with the molecular formula C11H9ClFN and a molecular weight of 209.65 g/mol. IUPAC name: 2-chloro-5-fluoro-3,8-dimethylquinoline. InChIKey: VHZSLPPYDBJXMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9ClFN
Molecular weight209.65 g/mol
IUPAC name2-chloro-5-fluoro-3,8-dimethylquinoline
InChIKeyVHZSLPPYDBJXMQ-UHFFFAOYSA-N
SMILESCC1=C2C(=C(C=C1)F)C=C(C(=N2)Cl)C

Computed by PubChem (NCBI)