CAS 915722-86-0 appears in our catalog under these names: 4-chloro-6-fluoro-2,3-dimethylquinoline, 98%, 4-Chloro-6-fluoro-2,3-dimethylquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
4-chloro-6-fluoro-2,3-dimethylquinoline (CAS 915722-86-0) is a chemical compound with the molecular formula C11H9ClFN and a molecular weight of 209.65 g/mol. IUPAC name: 4-chloro-6-fluoro-2,3-dimethylquinoline. InChIKey: WMAAHINMYSWZSK-UHFFFAOYSA-N.
| Molecular formula | C11H9ClFN |
|---|---|
| Molecular weight | 209.65 g/mol |
| IUPAC name | 4-chloro-6-fluoro-2,3-dimethylquinoline |
| InChIKey | WMAAHINMYSWZSK-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C=CC(=CC2=C1Cl)F)C |
Computed by PubChem (NCBI)