Products 1184526-89-3
CAS 1184526-89-3 appears in our catalog under these names: 3–(4–bromophenyl)pentan–3–amine hydrochloride, 3-(4-bromophenyl)pentan-3-amine hydrochloride. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg, 25mg.
3-(4-bromophenyl)pentan-3-amine;hydrochloride (CAS 1184526-89-3) is a chemical compound with the molecular formula C11H17BrClN and a molecular weight of 278.61 g/mol. IUPAC name: 3-(4-bromophenyl)pentan-3-amine;hydrochloride. InChIKey: JHOLZTGYLZHENL-UHFFFAOYSA-N.
| Molecular formula | C11H17BrClN |
|---|---|
| Molecular weight | 278.61 g/mol |
| IUPAC name | 3-(4-bromophenyl)pentan-3-amine;hydrochloride |
| InChIKey | JHOLZTGYLZHENL-UHFFFAOYSA-N |
| SMILES | CCC(CC)(C1=CC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)