CAS 1184827-15-3 appears in our catalog under these names: 4-(4-Nitrophenoxy)pyridine-2-carboxylic acid, 95%, 4-(4-Nitrophenoxy)pyridine-2-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
4-(4-nitrophenoxy)pyridine-2-carboxylic acid (CAS 1184827-15-3) is a chemical compound with the molecular formula C12H8N2O5 and a molecular weight of 260.20 g/mol. IUPAC name: 4-(4-nitrophenoxy)pyridine-2-carboxylic acid. InChIKey: BFNWVKMNCATLFU-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O5 |
|---|---|
| Molecular weight | 260.20 g/mol |
| IUPAC name | 4-(4-nitrophenoxy)pyridine-2-carboxylic acid |
| InChIKey | BFNWVKMNCATLFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2=CC(=NC=C2)C(=O)O |
Computed by PubChem (NCBI)