Products 1951444-50-0

CAS 1951444-50-0 is the registry number for 1-(4-Nitrophenyl)-2-oxopyridine-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(4-nitrophenyl)-2-oxopyridine-3-carboxylic acid (CAS 1951444-50-0) is a chemical compound with the molecular formula C12H8N2O5 and a molecular weight of 260.20 g/mol. IUPAC name: 1-(4-nitrophenyl)-2-oxopyridine-3-carboxylic acid. InChIKey: FUIJYCKOHMZKNT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8N2O5
Molecular weight260.20 g/mol
IUPAC name1-(4-nitrophenyl)-2-oxopyridine-3-carboxylic acid
InChIKeyFUIJYCKOHMZKNT-UHFFFAOYSA-N
SMILESC1=CN(C(=O)C(=C1)C(=O)O)C2=CC=C(C=C2)[N+](=O)[O-]

Computed by PubChem (NCBI)